C15H26N4 — CID 112909304
4-methyl-N,N-dipropyl-6-pyrrolidin-1-ylpyrimidin-2-amine (PubChem CID 112909304) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-methyl-N,N-dipropyl-6-pyrrolidin-1-ylpyrimidin-2-amine.
| Compound Name | 4-methyl-N,N-dipropyl-6-pyrrolidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112909304 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 4-methyl-N,N-dipropyl-6-pyrrolidin-1-ylpyrimidin-2-amine |
| SMILES | CCCN(CCC)c1nc(C)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C15H26N4/c1-4-8-19(9-5-2)15-16-13(3)12-14(17-15)18-10-6-7-11-18/h12H,4-11H2,1-3H3 |
| InChIKey | LIRBPUYEWCANTJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |