C19H27N3O4 — CID 109088568
4-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-N-pentylpyridine-2-carboxamide (PubChem CID 109088568) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-N-pentylpyridine-2-carboxamide.
| Compound Name | 4-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-N-pentylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109088568 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 4-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-N-pentylpyridine-2-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(C(=O)N2CCC3(CC2)OCCO3)ccn1 |
| InChI | InChI=1S/C19H27N3O4/c1-2-3-4-8-21-17(23)16-14-15(5-9-20-16)18(24)22-10-6-19(7-11-22)25-12-13-26-19/h5,9,14H,2-4,6-8,10-13H2,1H3,(H,21,23) |
| InChIKey | MTAHZEIGMJBSRQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|