C22H29N3O4 — CID 109082072
N-[2-(cyclohexen-1-yl)ethyl]-4-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyridine-2-carboxamide (PubChem CID 109082072) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyridine-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109082072 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cc(C(=O)N2CCC3(CC2)OCCO3)ccn1 |
| InChI | InChI=1S/C22H29N3O4/c26-20(24-10-6-17-4-2-1-3-5-17)19-16-18(7-11-23-19)21(27)25-12-8-22(9-13-25)28-14-15-29-22/h4,7,11,16H,1-3,5-6,8-10,12-15H2,(H,24,26) |
| InChIKey | DDIXOSNMUUWMGR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|