C17H26N4O3 — CID 109261570
1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[2-(pentylamino)pyrimidin-5-yl]methanone (PubChem CID 109261570) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[2-(pentylamino)pyrimidin-5-yl]methanone.
| Compound Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[2-(pentylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 109261570 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[2-(pentylamino)pyrimidin-5-yl]methanone |
| SMILES | CCCCCNc1ncc(C(=O)N2CCC3(CC2)OCCO3)cn1 |
| InChI | InChI=1S/C17H26N4O3/c1-2-3-4-7-18-16-19-12-14(13-20-16)15(22)21-8-5-17(6-9-21)23-10-11-24-17/h12-13H,2-11H2,1H3,(H,18,19,20) |
| InChIKey | HUIAEQRCIKOIHS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|