C14H19N3O2 — CID 109079060
4-N-tert-butyl-2-N-prop-2-enylpyridine-2,4-dicarboxamide (PubChem CID 109079060) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-N-tert-butyl-2-N-prop-2-enylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-tert-butyl-2-N-prop-2-enylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109079060 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-N-tert-butyl-2-N-prop-2-enylpyridine-2,4-dicarboxamide |
| SMILES | C=CCNC(=O)c1cc(C(=O)NC(C)(C)C)ccn1 |
| InChI | InChI=1S/C14H19N3O2/c1-5-7-16-13(19)11-9-10(6-8-15-11)12(18)17-14(2,3)4/h5-6,8-9H,1,7H2,2-4H3,(H,16,19)(H,17,18) |
| InChIKey | WJOHJIHJEXOCTK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|