C19H25Cl2NO3 — CID 69247827
ethyl 1-[5-(4-chlorophenyl)-3-oxopent-4-enyl]piperidine-3-carboxylate;hydrochloride (PubChem CID 69247827) has the molecular formula C19H25Cl2NO3 and a molecular weight of 386.32 g/mol. Its IUPAC name is ethyl 1-[5-(4-chlorophenyl)-3-oxopent-4-enyl]piperidine-3-carboxylate;hydrochloride.
| Compound Name | ethyl 1-[5-(4-chlorophenyl)-3-oxopent-4-enyl]piperidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 69247827 |
| Molecular Formula | C19H25Cl2NO3 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | ethyl 1-[5-(4-chlorophenyl)-3-oxopent-4-enyl]piperidine-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CCCN(CCC(=O)C=Cc2ccc(Cl)cc2)C1.Cl |
| InChI | InChI=1S/C19H24ClNO3.ClH/c1-2-24-19(23)16-4-3-12-21(14-16)13-11-18(22)10-7-15-5-8-17(20)9-6-15;/h5-10,16H,2-4,11-14H2,1H3;1H |
| InChIKey | HLCFTSBUEBSZLO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|