C15H13Cl2NO3 — CID 79192531
4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79192531) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is 4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79192531 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)NC1C=CC(C(=O)O)C1 |
| InChI | InChI=1S/C15H13Cl2NO3/c16-11-4-1-9(13(17)8-11)3-6-14(19)18-12-5-2-10(7-12)15(20)21/h1-6,8,10,12H,7H2,(H,18,19)(H,20,21) |
| InChIKey | QWNQKPLAKRCOOJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|