C17H24Br2N4O3S — CID 162667099
1-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 162667099) has the molecular formula C17H24Br2N4O3S and a molecular weight of 524.28 g/mol. Its IUPAC name is 1-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 162667099 |
| Molecular Formula | C17H24Br2N4O3S |
| Molecular Weight | 524.28 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | 1-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | COc1cc(/C=N/NC(=S)NCCCN2CCOCC2)c(Br)c(Br)c1OC |
| InChI | InChI=1S/C17H24Br2N4O3S/c1-24-13-10-12(14(18)15(19)16(13)25-2)11-21-22-17(27)20-4-3-5-23-6-8-26-9-7-23/h10-11H,3-9H2,1-2H3,(H2,20,22,27)/b21-11+ |
| InChIKey | HTLQCKDZZPPMBP-SRZZPIQSSA-N |
| XLogP | 2.75 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|