C17H16ClN7O4 — CID 136874686
N-[(Z)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide (PubChem CID 136874686) has the molecular formula C17H16ClN7O4 and a molecular weight of 417.81 g/mol. Its IUPAC name is N-[(Z)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136874686 |
| Molecular Formula | C17H16ClN7O4 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[(Z)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2cc(C)nn2-c2nnc(C)c(=O)[nH]2)c(Cl)c1O |
| InChI | InChI=1S/C17H16ClN7O4/c1-8-6-11(25(24-8)17-20-15(27)9(2)21-23-17)16(28)22-19-7-10-4-5-12(29-3)14(26)13(10)18/h4-7,26H,1-3H3,(H,22,28)(H,20,23,27)/b19-7- |
| InChIKey | KCUSKDUTCOBNHH-GXHLCREISA-N |
| XLogP | 1.10 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|