C16H13Cl2N7O2 — CID 136874722
N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide (PubChem CID 136874722) has the molecular formula C16H13Cl2N7O2 and a molecular weight of 406.23 g/mol. Its IUPAC name is N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136874722 |
| Molecular Formula | C16H13Cl2N7O2 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C\c2c(Cl)cccc2Cl)n(-c2nnc(C)c(=O)[nH]2)n1 |
| InChI | InChI=1S/C16H13Cl2N7O2/c1-8-6-13(25(24-8)16-20-14(26)9(2)21-23-16)15(27)22-19-7-10-11(17)4-3-5-12(10)18/h3-7H,1-2H3,(H,22,27)(H,20,23,26)/b19-7- |
| InChIKey | XVAHXZVWYDDEAR-GXHLCREISA-N |
| XLogP | 2.04 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|