C16H14N8O4 — CID 136874712
5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 136874712) has the molecular formula C16H14N8O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is 5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136874712 |
| Molecular Formula | C16H14N8O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C\c2ccc([N+](=O)[O-])cc2)n(-c2nnc(C)c(=O)[nH]2)n1 |
| InChI | InChI=1S/C16H14N8O4/c1-9-7-13(23(22-9)16-18-14(25)10(2)19-21-16)15(26)20-17-8-11-3-5-12(6-4-11)24(27)28/h3-8H,1-2H3,(H,20,26)(H,18,21,25)/b17-8- |
| InChIKey | DFQHNJWQWGAXGD-IUXPMGMMSA-N |
| XLogP | 0.64 |
| TPSA | 161.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|