C19H18N8O2 — CID 136874690
5-methyl-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide (PubChem CID 136874690) has the molecular formula C19H18N8O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is 5-methyl-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136874690 |
| Molecular Formula | C19H18N8O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 5-methyl-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C\c2c(C)[nH]c3ccccc23)n(-c2nnc(C)c(=O)[nH]2)n1 |
| InChI | InChI=1S/C19H18N8O2/c1-10-8-16(27(26-10)19-22-17(28)12(3)23-25-19)18(29)24-20-9-14-11(2)21-15-7-5-4-6-13(14)15/h4-9,21H,1-3H3,(H,24,29)(H,22,25,28)/b20-9- |
| InChIKey | PVVCBMMCOUHNPA-UKWGHVSLSA-N |
| XLogP | 1.52 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|