C17H14F3N7O2 — CID 136874600
5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]pyrazole-3-carboxamide (PubChem CID 136874600) has the molecular formula C17H14F3N7O2 and a molecular weight of 405.34 g/mol. Its IUPAC name is 5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136874600 |
| Molecular Formula | C17H14F3N7O2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C\c2cccc(C(F)(F)F)c2)n(-c2nnc(C)c(=O)[nH]2)n1 |
| InChI | InChI=1S/C17H14F3N7O2/c1-9-6-13(27(26-9)16-22-14(28)10(2)23-25-16)15(29)24-21-8-11-4-3-5-12(7-11)17(18,19)20/h3-8H,1-2H3,(H,24,29)(H,22,25,28)/b21-8- |
| InChIKey | SUTWMVJATLVBKW-WNFQYIGGSA-N |
| XLogP | 1.75 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|