C18H18ClN7O3 — CID 136874660
N-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide (PubChem CID 136874660) has the molecular formula C18H18ClN7O3 and a molecular weight of 415.84 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136874660 |
| Molecular Formula | C18H18ClN7O3 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]-5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)c2cc(C)nn2-c2nnc(C)c(=O)[nH]2)cc1Cl |
| InChI | InChI=1S/C18H18ClN7O3/c1-4-29-15-6-5-12(8-13(15)19)9-20-23-17(28)14-7-10(2)25-26(14)18-21-16(27)11(3)22-24-18/h5-9H,4H2,1-3H3,(H,23,28)(H,21,24,27)/b20-9- |
| InChIKey | KSJXMWODHCIJHD-UKWGHVSLSA-N |
| XLogP | 1.78 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|