C20H23N7O3 — CID 136874683
5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-[3-(2-methylpropoxy)phenyl]methylideneamino]pyrazole-3-carboxamide (PubChem CID 136874683) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is 5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-[3-(2-methylpropoxy)phenyl]methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-[3-(2-methylpropoxy)phenyl]methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136874683 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 5-methyl-2-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)-N-[(Z)-[3-(2-methylpropoxy)phenyl]methylideneamino]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C\c2cccc(OCC(C)C)c2)n(-c2nnc(C)c(=O)[nH]2)n1 |
| InChI | InChI=1S/C20H23N7O3/c1-12(2)11-30-16-7-5-6-15(9-16)10-21-24-19(29)17-8-13(3)26-27(17)20-22-18(28)14(4)23-25-20/h5-10,12H,11H2,1-4H3,(H,24,29)(H,22,25,28)/b21-10- |
| InChIKey | YOQPFAKIOKBCHH-FBHDLOMBSA-N |
| XLogP | 1.77 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|