C15H13N7O3 — CID 749044
5,7-dimethyl-N-[(4-nitrophenyl)methylideneamino]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 749044) has the molecular formula C15H13N7O3 and a molecular weight of 339.32 g/mol. Its IUPAC name is 5,7-dimethyl-N-[(4-nitrophenyl)methylideneamino]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5,7-dimethyl-N-[(4-nitrophenyl)methylideneamino]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 749044 |
| Molecular Formula | C15H13N7O3 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5,7-dimethyl-N-[(4-nitrophenyl)methylideneamino]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C)n2nc(C(=O)NN=Cc3ccc([N+](=O)[O-])cc3)nc2n1 |
| InChI | InChI=1S/C15H13N7O3/c1-9-7-10(2)21-15(17-9)18-13(20-21)14(23)19-16-8-11-3-5-12(6-4-11)22(24)25/h3-8H,1-2H3,(H,19,23) |
| InChIKey | WDICYECLTUKWAM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|