C11H8Cl2N4OS — CID 4055872
N-[(2,6-dichlorophenyl)methylideneamino]-4-methylthiadiazole-5-carboxamide (PubChem CID 4055872) has the molecular formula C11H8Cl2N4OS and a molecular weight of 315.19 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methylideneamino]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[(2,6-dichlorophenyl)methylideneamino]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 4055872 |
| Molecular Formula | C11H8Cl2N4OS |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methylideneamino]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NN=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H8Cl2N4OS/c1-6-10(19-17-15-6)11(18)16-14-5-7-8(12)3-2-4-9(7)13/h2-5H,1H3,(H,16,18) |
| InChIKey | KWZNENJJTGGILW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|