C8H7N5OS2 — CID 146025236
4-methyl-N-[(E)-1,3-thiazol-5-ylmethylideneamino]thiadiazole-5-carboxamide (PubChem CID 146025236) has the molecular formula C8H7N5OS2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-methyl-N-[(E)-1,3-thiazol-5-ylmethylideneamino]thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[(E)-1,3-thiazol-5-ylmethylideneamino]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 146025236 |
| Molecular Formula | C8H7N5OS2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 4-methyl-N-[(E)-1,3-thiazol-5-ylmethylideneamino]thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)N/N=C/c1cncs1 |
| InChI | InChI=1S/C8H7N5OS2/c1-5-7(16-13-11-5)8(14)12-10-3-6-2-9-4-15-6/h2-4H,1H3,(H,12,14)/b10-3+ |
| InChIKey | BUIIYJBNWKXHKP-XCVCLJGOSA-N |
| XLogP | 1.07 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|