C17H17N3O5S — CID 110518431
2-oxo-N-[(E)-(2-propoxyphenyl)methylideneamino]-3H-1,3-benzoxazole-6-sulfonamide (PubChem CID 110518431) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-oxo-N-[(E)-(2-propoxyphenyl)methylideneamino]-3H-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 2-oxo-N-[(E)-(2-propoxyphenyl)methylideneamino]-3H-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 110518431 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-oxo-N-[(E)-(2-propoxyphenyl)methylideneamino]-3H-1,3-benzoxazole-6-sulfonamide |
| SMILES | CCCOc1ccccc1/C=N/NS(=O)(=O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C17H17N3O5S/c1-2-9-24-15-6-4-3-5-12(15)11-18-20-26(22,23)13-7-8-14-16(10-13)25-17(21)19-14/h3-8,10-11,20H,2,9H2,1H3,(H,19,21)/b18-11+ |
| InChIKey | AEFGWFDJQSGFGH-WOJGMQOQSA-N |
| XLogP | 2.22 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|