C15H10F3N3O4S — CID 110518298
2-oxo-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-3H-1,3-benzoxazole-6-sulfonamide (PubChem CID 110518298) has the molecular formula C15H10F3N3O4S and a molecular weight of 385.32 g/mol. Its IUPAC name is 2-oxo-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-3H-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 2-oxo-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-3H-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 110518298 |
| Molecular Formula | C15H10F3N3O4S |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-oxo-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-3H-1,3-benzoxazole-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N/N=C/c3cccc(C(F)(F)F)c3)cc2o1 |
| InChI | InChI=1S/C15H10F3N3O4S/c16-15(17,18)10-3-1-2-9(6-10)8-19-21-26(23,24)11-4-5-12-13(7-11)25-14(22)20-12/h1-8,21H,(H,20,22)/b19-8+ |
| InChIKey | FKYBAHLVCUKQTM-UFWORHAWSA-N |
| XLogP | 2.45 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|