C14H9Cl2N3O4S — CID 110518452
N-[(E)-(2,6-dichlorophenyl)methylideneamino]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide (PubChem CID 110518452) has the molecular formula C14H9Cl2N3O4S and a molecular weight of 386.22 g/mol. Its IUPAC name is N-[(E)-(2,6-dichlorophenyl)methylideneamino]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 110518452 |
| Molecular Formula | C14H9Cl2N3O4S |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N/N=C/c3c(Cl)cccc3Cl)cc2o1 |
| InChI | InChI=1S/C14H9Cl2N3O4S/c15-10-2-1-3-11(16)9(10)7-17-19-24(21,22)8-4-5-12-13(6-8)23-14(20)18-12/h1-7,19H,(H,18,20)/b17-7+ |
| InChIKey | XHDLCTKCFWDDCE-REZTVBANSA-N |
| XLogP | 2.74 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|