C32H22Cl2N2O4 — CID 51061902
[1-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate (PubChem CID 51061902) has the molecular formula C32H22Cl2N2O4 and a molecular weight of 569.44 g/mol. Its IUPAC name is [1-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate.
| Compound Name | [1-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 51061902 |
| Molecular Formula | C32H22Cl2N2O4 |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | [1-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
| SMILES | O=C(N/N=C/c1c(OC(=O)c2ccccc2)ccc2ccccc12)c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C32H22Cl2N2O4/c33-25-14-10-24(29(34)18-25)20-39-26-15-11-22(12-16-26)31(37)36-35-19-28-27-9-5-4-6-21(27)13-17-30(28)40-32(38)23-7-2-1-3-8-23/h1-19H,20H2,(H,36,37)/b35-19+ |
| InChIKey | IQUXIIGGEMHZOZ-XZYGTATASA-N |
| XLogP | 7.71 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|