C32H25BrClN5O3S — CID 126268118
N-[(Z)-[3-bromo-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126268118) has the molecular formula C32H25BrClN5O3S and a molecular weight of 675.01 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(Z)-[3-bromo-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126268118 |
| Molecular Formula | C32H25BrClN5O3S |
| Molecular Weight | 675.01 g/mol |
| Exact Mass | 673.06 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(/C=N\NC(=O)c2ccc(-c3csc(Nc4ccc(Cl)cc4)n3)cc2)cc1Br |
| InChI | InChI=1S/C32H25BrClN5O3S/c1-20-4-2-3-5-27(20)37-30(40)18-42-29-15-6-21(16-26(29)33)17-35-39-31(41)23-9-7-22(8-10-23)28-19-43-32(38-28)36-25-13-11-24(34)12-14-25/h2-17,19H,18H2,1H3,(H,36,38)(H,37,40)(H,39,41)/b35-17- |
| InChIKey | GGCMMDNAWRJVLO-QMRORBIVSA-N |
| XLogP | 8.06 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.01 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|