C33H27BrClN5O3S — CID 126262382
N-[(Z)-[5-bromo-2-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126262382) has the molecular formula C33H27BrClN5O3S and a molecular weight of 689.04 g/mol. Its IUPAC name is N-[(Z)-[5-bromo-2-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(Z)-[5-bromo-2-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126262382 |
| Molecular Formula | C33H27BrClN5O3S |
| Molecular Weight | 689.04 g/mol |
| Exact Mass | 687.07 |
| IUPAC Name | N-[(Z)-[5-bromo-2-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(Br)cc2/C=N\NC(=O)c2ccc(-c3csc(Nc4ccc(Cl)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C33H27BrClN5O3S/c1-20-3-13-28(21(2)15-20)38-31(41)18-43-30-14-8-25(34)16-24(30)17-36-40-32(42)23-6-4-22(5-7-23)29-19-44-33(39-29)37-27-11-9-26(35)10-12-27/h3-17,19H,18H2,1-2H3,(H,37,39)(H,38,41)(H,40,42)/b36-17- |
| InChIKey | KGQJBCGWIHTBAJ-RODHXAHZSA-N |
| XLogP | 8.37 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.04 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|