C27H23ClN4O4S — CID 46916210
ethyl 2-[4-[(E)-[[4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 46916210) has the molecular formula C27H23ClN4O4S and a molecular weight of 535.03 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[[4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[[4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 46916210 |
| Molecular Formula | C27H23ClN4O4S |
| Molecular Weight | 535.03 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | ethyl 2-[4-[(E)-[[4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]benzoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=N/NC(=O)c2ccc(-c3csc(Nc4ccc(Cl)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C27H23ClN4O4S/c1-2-35-25(33)16-36-23-13-3-18(4-14-23)15-29-32-26(34)20-7-5-19(6-8-20)24-17-37-27(31-24)30-22-11-9-21(28)10-12-22/h3-15,17H,2,16H2,1H3,(H,30,31)(H,32,34)/b29-15+ |
| InChIKey | PKFIQXJXXKWFOJ-WKULSOCRSA-N |
| XLogP | 5.91 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.03 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|