C28H26N4O2 — CID 124546755
N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-oxobenzo[cd]indol-1-yl)acetamide (PubChem CID 124546755) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-oxobenzo[cd]indol-1-yl)acetamide.
| Compound Name | N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-oxobenzo[cd]indol-1-yl)acetamide |
|---|---|
| PubChem CID | 124546755 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-oxobenzo[cd]indol-1-yl)acetamide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=N\NC(=O)CN3C(=O)c4cccc5cccc3c45)c2C)cc1C |
| InChI | InChI=1S/C28H26N4O2/c1-17-11-12-23(13-18(17)2)32-19(3)14-22(20(32)4)15-29-30-26(33)16-31-25-10-6-8-21-7-5-9-24(27(21)25)28(31)34/h5-15H,16H2,1-4H3,(H,30,33)/b29-15- |
| InChIKey | DRHAXKZBTCTQAU-FDVSRXAVSA-N |
| XLogP | 4.97 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|