C20H14N4O4 — CID 6906307
N-[(E)-(4-nitrophenyl)methylideneamino]-2-(2-oxobenzo[cd]indol-1-yl)acetamide (PubChem CID 6906307) has the molecular formula C20H14N4O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is N-[(E)-(4-nitrophenyl)methylideneamino]-2-(2-oxobenzo[cd]indol-1-yl)acetamide.
| Compound Name | N-[(E)-(4-nitrophenyl)methylideneamino]-2-(2-oxobenzo[cd]indol-1-yl)acetamide |
|---|---|
| PubChem CID | 6906307 |
| Molecular Formula | C20H14N4O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-[(E)-(4-nitrophenyl)methylideneamino]-2-(2-oxobenzo[cd]indol-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc3cccc1c23)N/N=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H14N4O4/c25-18(22-21-11-13-7-9-15(10-8-13)24(27)28)12-23-17-6-2-4-14-3-1-5-16(19(14)17)20(23)26/h1-11H,12H2,(H,22,25)/b21-11+ |
| InChIKey | PBQUSFKXDBSWBT-SRZZPIQSSA-N |
| XLogP | 2.86 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|