C25H23BrN8O4 — CID 3771868
2-[2-bromo-4-[[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetonitrile (PubChem CID 3771868) has the molecular formula C25H23BrN8O4 and a molecular weight of 579.42 g/mol. Its IUPAC name is 2-[2-bromo-4-[[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-4-[[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 3771868 |
| Molecular Formula | C25H23BrN8O4 |
| Molecular Weight | 579.42 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | 2-[2-bromo-4-[[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetonitrile |
| SMILES | COc1ccc(Nc2nc(NCc3ccco3)nc(NN=Cc3cc(Br)c(OCC#N)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C25H23BrN8O4/c1-35-18-7-5-17(6-8-18)30-24-31-23(28-15-19-4-3-10-37-19)32-25(33-24)34-29-14-16-12-20(26)22(38-11-9-27)21(13-16)36-2/h3-8,10,12-14H,11,15H2,1-2H3,(H3,28,30,31,32,33,34) |
| InChIKey | MJVRQACQIJWTCI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|