C22H20ClN9O7 — CID 136611937
2-[(E)-[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol;hydrochloride (PubChem CID 136611937) has the molecular formula C22H20ClN9O7 and a molecular weight of 557.91 g/mol. Its IUPAC name is 2-[(E)-[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol;hydrochloride.
| Compound Name | 2-[(E)-[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol;hydrochloride |
|---|---|
| PubChem CID | 136611937 |
| Molecular Formula | C22H20ClN9O7 |
| Molecular Weight | 557.91 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | 2-[(E)-[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol;hydrochloride |
| SMILES | COc1ccc(Nc2nc(NCc3ccco3)nc(N/N=C/c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3O)n2)cc1.Cl |
| InChI | InChI=1S/C22H19N9O7.ClH/c1-37-16-6-4-14(5-7-16)25-21-26-20(23-12-17-3-2-8-38-17)27-22(28-21)29-24-11-13-9-15(30(33)34)10-18(19(13)32)31(35)36;/h2-11,32H,12H2,1H3,(H3,23,25,26,27,28,29);1H/b24-11+; |
| InChIKey | NDBWXRJEHBZZCX-IQIGYLCLSA-N |
| XLogP | 4.22 |
| TPSA | 216.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.91 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|