C22H20Cl3N7O2 — CID 91962050
2-N-[(2,4-dichlorophenyl)methylideneamino]-6-N-(furan-2-ylmethyl)-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;hydrochloride (PubChem CID 91962050) has the molecular formula C22H20Cl3N7O2 and a molecular weight of 520.81 g/mol. Its IUPAC name is 2-N-[(2,4-dichlorophenyl)methylideneamino]-6-N-(furan-2-ylmethyl)-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;hydrochloride.
| Compound Name | 2-N-[(2,4-dichlorophenyl)methylideneamino]-6-N-(furan-2-ylmethyl)-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;hydrochloride |
|---|---|
| PubChem CID | 91962050 |
| Molecular Formula | C22H20Cl3N7O2 |
| Molecular Weight | 520.81 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 2-N-[(2,4-dichlorophenyl)methylideneamino]-6-N-(furan-2-ylmethyl)-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;hydrochloride |
| SMILES | COc1ccc(Nc2nc(NCc3ccco3)nc(NN=Cc3ccc(Cl)cc3Cl)n2)cc1.Cl |
| InChI | InChI=1S/C22H19Cl2N7O2.ClH/c1-32-17-8-6-16(7-9-17)27-21-28-20(25-13-18-3-2-10-33-18)29-22(30-21)31-26-12-14-4-5-15(23)11-19(14)24;/h2-12H,13H2,1H3,(H3,25,27,28,29,30,31);1H |
| InChIKey | RTNFAEULWDDGFK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.81 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|