C24H24ClN7O4 — CID 137127287
2-chloro-6-ethoxy-4-[(Z)-[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 137127287) has the molecular formula C24H24ClN7O4 and a molecular weight of 509.95 g/mol. Its IUPAC name is 2-chloro-6-ethoxy-4-[(Z)-[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-chloro-6-ethoxy-4-[(Z)-[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 137127287 |
| Molecular Formula | C24H24ClN7O4 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 2-chloro-6-ethoxy-4-[(Z)-[[4-(furan-2-ylmethylamino)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | CCOc1cc(/C=N\Nc2nc(NCc3ccco3)nc(Nc3ccc(OC)cc3)n2)cc(Cl)c1O |
| InChI | InChI=1S/C24H24ClN7O4/c1-3-35-20-12-15(11-19(25)21(20)33)13-27-32-24-30-22(26-14-18-5-4-10-36-18)29-23(31-24)28-16-6-8-17(34-2)9-7-16/h4-13,33H,3,14H2,1-2H3,(H3,26,28,29,30,31,32)/b27-13- |
| InChIKey | IMKMLXAMCWCKGH-WKIKZPBSSA-N |
| XLogP | 5.03 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|