C21H22N6O5 — CID 110514431
5-[(2E)-2-[[4-[(2,5-dimethylphenyl)methoxy]-3-methoxy-5-nitrophenyl]methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one (PubChem CID 110514431) has the molecular formula C21H22N6O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is 5-[(2E)-2-[[4-[(2,5-dimethylphenyl)methoxy]-3-methoxy-5-nitrophenyl]methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[(2E)-2-[[4-[(2,5-dimethylphenyl)methoxy]-3-methoxy-5-nitrophenyl]methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 110514431 |
| Molecular Formula | C21H22N6O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 5-[(2E)-2-[[4-[(2,5-dimethylphenyl)methoxy]-3-methoxy-5-nitrophenyl]methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one |
| SMILES | COc1cc(/C=N/Nc2nc(=O)[nH]nc2C)cc([N+](=O)[O-])c1OCc1cc(C)ccc1C |
| InChI | InChI=1S/C21H22N6O5/c1-12-5-6-13(2)16(7-12)11-32-19-17(27(29)30)8-15(9-18(19)31-4)10-22-25-20-14(3)24-26-21(28)23-20/h5-10H,11H2,1-4H3,(H2,23,25,26,28)/b22-10+ |
| InChIKey | JPHABTHTPCHULS-LSHDLFTRSA-N |
| XLogP | 3.03 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|