C24H23N5O4 — CID 110511895
N-[(Z)-[3-methoxy-4-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-6-methyl-1H-benzimidazol-2-amine (PubChem CID 110511895) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is N-[(Z)-[3-methoxy-4-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-6-methyl-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-[3-methoxy-4-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-6-methyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 110511895 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[(Z)-[3-methoxy-4-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-6-methyl-1H-benzimidazol-2-amine |
| SMILES | COc1cc(/C=N\Nc2nc3ccc(C)cc3[nH]2)cc([N+](=O)[O-])c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C24H23N5O4/c1-15-5-4-6-17(9-15)14-33-23-21(29(30)31)11-18(12-22(23)32-3)13-25-28-24-26-19-8-7-16(2)10-20(19)27-24/h4-13H,14H2,1-3H3,(H2,26,27,28)/b25-13- |
| InChIKey | FLSYSIHIWIWKJT-MXAYSNPKSA-N |
| XLogP | 5.12 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|