C22H20ClN3O4 — CID 110506111
4-chloro-N-[(E)-[3-methoxy-4-[(4-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]aniline (PubChem CID 110506111) has the molecular formula C22H20ClN3O4 and a molecular weight of 425.87 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[3-methoxy-4-[(4-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]aniline.
| Compound Name | 4-chloro-N-[(E)-[3-methoxy-4-[(4-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 110506111 |
| Molecular Formula | C22H20ClN3O4 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 4-chloro-N-[(E)-[3-methoxy-4-[(4-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]aniline |
| SMILES | COc1cc(/C=N/Nc2ccc(Cl)cc2)cc([N+](=O)[O-])c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C22H20ClN3O4/c1-15-3-5-16(6-4-15)14-30-22-20(26(27)28)11-17(12-21(22)29-2)13-24-25-19-9-7-18(23)8-10-19/h3-13,25H,14H2,1-2H3/b24-13+ |
| InChIKey | UDHDVOVJPBJRDZ-ZMOGYAJESA-N |
| XLogP | 5.59 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|