C20H23N5O4 — CID 110511910
N-[(Z)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-6-methyl-1H-benzimidazol-2-amine (PubChem CID 110511910) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-6-methyl-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-6-methyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 110511910 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[(Z)-(3-ethoxy-5-nitro-4-propoxyphenyl)methylideneamino]-6-methyl-1H-benzimidazol-2-amine |
| SMILES | CCCOc1c(OCC)cc(/C=N\Nc2nc3ccc(C)cc3[nH]2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N5O4/c1-4-8-29-19-17(25(26)27)10-14(11-18(19)28-5-2)12-21-24-20-22-15-7-6-13(3)9-16(15)23-20/h6-7,9-12H,4-5,8H2,1-3H3,(H2,22,23,24)/b21-12- |
| InChIKey | ZNTGMSPONPZJBC-MTJSOVHGSA-N |
| XLogP | 4.41 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|