C17H21N5O6 — CID 136788619
2-[(2Z)-2-[(3-ethoxy-4-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 136788619) has the molecular formula C17H21N5O6 and a molecular weight of 391.38 g/mol. Its IUPAC name is 2-[(2Z)-2-[(3-ethoxy-4-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2Z)-2-[(3-ethoxy-4-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136788619 |
| Molecular Formula | C17H21N5O6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-[(2Z)-2-[(3-ethoxy-4-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCOc1cc(/C=N\Nc2nc(C)c(CCO)c(=O)[nH]2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C17H21N5O6/c1-4-28-14-8-11(7-13(22(25)26)15(14)27-3)9-18-21-17-19-10(2)12(5-6-23)16(24)20-17/h7-9,23H,4-6H2,1-3H3,(H2,19,20,21,24)/b18-9- |
| InChIKey | TWPSWUYRSWXOER-NVMNQCDNSA-N |
| XLogP | 1.37 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|