C17H22N4O4 — CID 136788555
2-[(2Z)-2-[(3-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 136788555) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[(2Z)-2-[(3-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2Z)-2-[(3-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136788555 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[(2Z)-2-[(3-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-5-(2-hydroxyethyl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCOc1cc(/C=N\Nc2nc(C)c(CCO)c(=O)[nH]2)ccc1OC |
| InChI | InChI=1S/C17H22N4O4/c1-4-25-15-9-12(5-6-14(15)24-3)10-18-21-17-19-11(2)13(7-8-22)16(23)20-17/h5-6,9-10,22H,4,7-8H2,1-3H3,(H2,19,20,21,23)/b18-10- |
| InChIKey | YKUGWRIITXNFQX-ZDLGFXPLSA-N |
| XLogP | 1.47 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|