C18H17I2N3O4 — CID 3922281
methyl 2-[2,6-diiodo-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3922281) has the molecular formula C18H17I2N3O4 and a molecular weight of 593.16 g/mol. Its IUPAC name is methyl 2-[2,6-diiodo-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2,6-diiodo-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3922281 |
| Molecular Formula | C18H17I2N3O4 |
| Molecular Weight | 593.16 g/mol |
| Exact Mass | 592.93 |
| IUPAC Name | methyl 2-[2,6-diiodo-4-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(C=NNC(=O)Nc2ccccc2C)cc1I |
| InChI | InChI=1S/C18H17I2N3O4/c1-11-5-3-4-6-15(11)22-18(25)23-21-9-12-7-13(19)17(14(20)8-12)27-10-16(24)26-2/h3-9H,10H2,1-2H3,(H2,22,23,25) |
| InChIKey | RDYKQJAQKLFLIY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|