C24H23IN4O5 — CID 3903034
1-[[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 3903034) has the molecular formula C24H23IN4O5 and a molecular weight of 574.38 g/mol. Its IUPAC name is 1-[[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 3903034 |
| Molecular Formula | C24H23IN4O5 |
| Molecular Weight | 574.38 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | 1-[[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | CCOc1cc(C=NNC(=O)Nc2ccccc2C)cc(I)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23IN4O5/c1-3-33-22-13-18(14-26-28-24(30)27-21-10-5-4-7-16(21)2)12-20(25)23(22)34-15-17-8-6-9-19(11-17)29(31)32/h4-14H,3,15H2,1-2H3,(H2,27,28,30) |
| InChIKey | LFQPIAYYBCAODE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.38 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|