C22H18FI2N3O2 — CID 5222032
1-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 5222032) has the molecular formula C22H18FI2N3O2 and a molecular weight of 629.21 g/mol. Its IUPAC name is 1-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 5222032 |
| Molecular Formula | C22H18FI2N3O2 |
| Molecular Weight | 629.21 g/mol |
| Exact Mass | 628.95 |
| IUPAC Name | 1-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NN=Cc1cc(I)c(OCc2cccc(F)c2)c(I)c1 |
| InChI | InChI=1S/C22H18FI2N3O2/c1-14-5-2-3-8-20(14)27-22(29)28-26-12-16-10-18(24)21(19(25)11-16)30-13-15-6-4-7-17(23)9-15/h2-12H,13H2,1H3,(H2,27,28,29) |
| InChIKey | LENDPXLADRQTSC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.21 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|