C26H22IN3O2 — CID 3636261
1-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 3636261) has the molecular formula C26H22IN3O2 and a molecular weight of 535.39 g/mol. Its IUPAC name is 1-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 3636261 |
| Molecular Formula | C26H22IN3O2 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | 1-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NN=Cc1ccc(OCc2ccc3ccccc3c2)c(I)c1 |
| InChI | InChI=1S/C26H22IN3O2/c1-18-6-2-5-9-24(18)29-26(31)30-28-16-19-11-13-25(23(27)15-19)32-17-20-10-12-21-7-3-4-8-22(21)14-20/h2-16H,17H2,1H3,(H2,29,30,31) |
| InChIKey | GHGRXLHSXAFUBR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|