C40H34N4O4 — CID 126015634
4-(2,5-diphenylpyrrol-1-yl)-N-[(Z)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126015634) has the molecular formula C40H34N4O4 and a molecular weight of 634.74 g/mol. Its IUPAC name is 4-(2,5-diphenylpyrrol-1-yl)-N-[(Z)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(2,5-diphenylpyrrol-1-yl)-N-[(Z)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126015634 |
| Molecular Formula | C40H34N4O4 |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | 4-(2,5-diphenylpyrrol-1-yl)-N-[(Z)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(-n3c(-c4ccccc4)ccc3-c3ccccc3)cc2)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C40H34N4O4/c1-28-11-9-10-16-34(28)42-39(45)27-48-37-24-17-29(25-38(37)47-2)26-41-43-40(46)32-18-20-33(21-19-32)44-35(30-12-5-3-6-13-30)22-23-36(44)31-14-7-4-8-15-31/h3-26H,27H2,1-2H3,(H,42,45)(H,43,46)/b41-26- |
| InChIKey | RXJTXJBRWPEIMF-ZLMSITSKSA-N |
| XLogP | 7.91 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|