C22H21N3O5 — CID 126023583
N-[(E)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]furan-2-carboxamide (PubChem CID 126023583) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[(E)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126023583 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[(E)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]furan-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccco2)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C22H21N3O5/c1-15-6-3-4-7-17(15)24-21(26)14-30-18-10-9-16(12-20(18)28-2)13-23-25-22(27)19-8-5-11-29-19/h3-13H,14H2,1-2H3,(H,24,26)(H,25,27)/b23-13+ |
| InChIKey | USKMVONHJWEWCI-YDZHTSKRSA-N |
| XLogP | 3.38 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|