C17H17BrN2O4 — CID 51061150
N-[(E)-(5-bromo-2-propoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide (PubChem CID 51061150) has the molecular formula C17H17BrN2O4 and a molecular weight of 393.24 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-propoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide.
| Compound Name | N-[(E)-(5-bromo-2-propoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 51061150 |
| Molecular Formula | C17H17BrN2O4 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | N-[(E)-(5-bromo-2-propoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide |
| SMILES | CCCOc1ccc(Br)cc1/C=N/NC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C17H17BrN2O4/c1-2-7-24-16-6-3-12(18)8-11(16)10-19-20-17(23)14-5-4-13(21)9-15(14)22/h3-6,8-10,21-22H,2,7H2,1H3,(H,20,23)/b19-10+ |
| InChIKey | ABZWEDVPTANRQW-VXLYETTFSA-N |
| XLogP | 3.41 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|