C26H18BrIN2O3 — CID 3423321
[4-[[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate (PubChem CID 3423321) has the molecular formula C26H18BrIN2O3 and a molecular weight of 613.25 g/mol. Its IUPAC name is [4-[[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate.
| Compound Name | [4-[[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 3423321 |
| Molecular Formula | C26H18BrIN2O3 |
| Molecular Weight | 613.25 g/mol |
| Exact Mass | 611.95 |
| IUPAC Name | [4-[[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| SMILES | O=C(Cc1ccc(Br)c2ccccc12)NN=Cc1ccc(OC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C26H18BrIN2O3/c27-23-14-11-18(20-5-1-2-6-21(20)23)15-25(31)30-29-16-17-9-12-19(13-10-17)33-26(32)22-7-3-4-8-24(22)28/h1-14,16H,15H2,(H,30,31) |
| InChIKey | LTHFJTADXJSKIF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.25 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|