C23H16N4O3 — CID 6291991
[4-[(Z)-(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 6291991) has the molecular formula C23H16N4O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is [4-[(Z)-(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[(Z)-(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 6291991 |
| Molecular Formula | C23H16N4O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [4-[(Z)-(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | O=C(N/N=C\c1ccc(OC(=O)c2cccc3ccccc23)cc1)c1cnccn1 |
| InChI | InChI=1S/C23H16N4O3/c28-22(21-15-24-12-13-25-21)27-26-14-16-8-10-18(11-9-16)30-23(29)20-7-3-5-17-4-1-2-6-19(17)20/h1-15H,(H,27,28)/b26-14- |
| InChIKey | JYULEMOGZBFGJJ-WGARJPEWSA-N |
| XLogP | 3.61 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|