C16H12ClN3O — CID 126210762
(2S)-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-cyano-2-phenylacetamide (PubChem CID 126210762) has the molecular formula C16H12ClN3O and a molecular weight of 297.75 g/mol. Its IUPAC name is (2S)-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-cyano-2-phenylacetamide.
| Compound Name | (2S)-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-cyano-2-phenylacetamide |
|---|---|
| PubChem CID | 126210762 |
| Molecular Formula | C16H12ClN3O |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (2S)-N-[(Z)-(4-chlorophenyl)methylideneamino]-2-cyano-2-phenylacetamide |
| SMILES | N#C[C@@H](C(=O)N/N=C\c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H12ClN3O/c17-14-8-6-12(7-9-14)11-19-20-16(21)15(10-18)13-4-2-1-3-5-13/h1-9,11,15H,(H,20,21)/b19-11-/t15-/m1/s1 |
| InChIKey | IMGPROLUIHXVLW-MXDDHBLUSA-N |
| XLogP | 3.10 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|