C14H11N3OS — CID 126211490
(2R)-2-cyano-2-phenyl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide (PubChem CID 126211490) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is (2R)-2-cyano-2-phenyl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide.
| Compound Name | (2R)-2-cyano-2-phenyl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 126211490 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (2R)-2-cyano-2-phenyl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| SMILES | N#C[C@H](C(=O)N/N=C\c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C14H11N3OS/c15-9-13(11-5-2-1-3-6-11)14(18)17-16-10-12-7-4-8-19-12/h1-8,10,13H,(H,17,18)/b16-10-/t13-/m0/s1 |
| InChIKey | GVVRHDSHVNFRSL-ATTDUZETSA-N |
| XLogP | 2.51 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|