C15H12N4O — CID 126203787
(2R)-2-cyano-2-phenyl-N-[(Z)-pyridin-3-ylmethylideneamino]acetamide (PubChem CID 126203787) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is (2R)-2-cyano-2-phenyl-N-[(Z)-pyridin-3-ylmethylideneamino]acetamide.
| Compound Name | (2R)-2-cyano-2-phenyl-N-[(Z)-pyridin-3-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 126203787 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (2R)-2-cyano-2-phenyl-N-[(Z)-pyridin-3-ylmethylideneamino]acetamide |
| SMILES | N#C[C@H](C(=O)N/N=C\c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C15H12N4O/c16-9-14(13-6-2-1-3-7-13)15(20)19-18-11-12-5-4-8-17-10-12/h1-8,10-11,14H,(H,19,20)/b18-11-/t14-/m0/s1 |
| InChIKey | IRNNEOZWLZXADC-DZBQEORWSA-N |
| XLogP | 1.84 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|