C9H12N4O2 — CID 172842868
(2S)-2-amino-3-hydroxy-N-(pyridin-3-ylmethylideneamino)propanamide (PubChem CID 172842868) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxy-N-(pyridin-3-ylmethylideneamino)propanamide.
| Compound Name | (2S)-2-amino-3-hydroxy-N-(pyridin-3-ylmethylideneamino)propanamide |
|---|---|
| PubChem CID | 172842868 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | (2S)-2-amino-3-hydroxy-N-(pyridin-3-ylmethylideneamino)propanamide |
| SMILES | N[C@@H](CO)C(=O)NN=Cc1cccnc1 |
| InChI | InChI=1S/C9H12N4O2/c10-8(6-14)9(15)13-12-5-7-2-1-3-11-4-7/h1-5,8,14H,6,10H2,(H,13,15)/t8-/m0/s1 |
| InChIKey | XANJCXICWNKOHC-QMMMGPOBSA-N |
| XLogP | -1.15 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|